C21H23F3N2O — CID 177447046
N-[(E)-4-butylimino-1,1,1-trifluoro-4-phenylbut-2-en-2-yl]-4-methoxyaniline (PubChem CID 177447046) has the molecular formula C21H23F3N2O and a molecular weight of 376.42 g/mol. Its IUPAC name is N-[(E)-4-butylimino-1,1,1-trifluoro-4-phenylbut-2-en-2-yl]-4-methoxyaniline.
| Compound Name | N-[(E)-4-butylimino-1,1,1-trifluoro-4-phenylbut-2-en-2-yl]-4-methoxyaniline |
|---|---|
| PubChem CID | 177447046 |
| Molecular Formula | C21H23F3N2O |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | N-[(E)-4-butylimino-1,1,1-trifluoro-4-phenylbut-2-en-2-yl]-4-methoxyaniline |
| SMILES | CCCC/N=C(/C=C(/Nc1ccc(OC)cc1)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C21H23F3N2O/c1-3-4-14-25-19(16-8-6-5-7-9-16)15-20(21(22,23)24)26-17-10-12-18(27-2)13-11-17/h5-13,15,26H,3-4,14H2,1-2H3/b20-15+,25-19- |
| InChIKey | HFFGNSUDWHBAAE-LKCLSHBFSA-N |
| XLogP | 5.84 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|