C19H22N2 — CID 11000397
(Z)-3-butylimino-1,3-diphenylprop-1-en-1-amine (PubChem CID 11000397) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is (Z)-3-butylimino-1,3-diphenylprop-1-en-1-amine.
| Compound Name | (Z)-3-butylimino-1,3-diphenylprop-1-en-1-amine |
|---|---|
| PubChem CID | 11000397 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | (Z)-3-butylimino-1,3-diphenylprop-1-en-1-amine |
| SMILES | CCCC/N=C(/C=C(\N)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H22N2/c1-2-3-14-21-19(17-12-8-5-9-13-17)15-18(20)16-10-6-4-7-11-16/h4-13,15H,2-3,14,20H2,1H3/b18-15-,21-19- |
| InChIKey | MGYJIKVYFUOJDT-RWTJFWDBSA-N |
| XLogP | 4.28 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|