C21H46N3+ — CID 163212730
(N,N-dibutyl-N'-propylcarbamimidoyl)-tripropylazanium (PubChem CID 163212730) has the molecular formula C21H46N3+ and a molecular weight of 340.62 g/mol. Its IUPAC name is (N,N-dibutyl-N'-propylcarbamimidoyl)-tripropylazanium.
| Compound Name | (N,N-dibutyl-N'-propylcarbamimidoyl)-tripropylazanium |
|---|---|
| PubChem CID | 163212730 |
| Molecular Formula | C21H46N3+ |
| Molecular Weight | 340.62 g/mol |
| Exact Mass | 340.37 |
| IUPAC Name | (N,N-dibutyl-N'-propylcarbamimidoyl)-tripropylazanium |
| SMILES | CCCCN(CCCC)/C(=N\CCC)[N+](CCC)(CCC)CCC |
| InChI | InChI=1S/C21H46N3/c1-7-13-16-23(17-14-8-2)21(22-15-9-3)24(18-10-4,19-11-5)20-12-6/h7-20H2,1-6H3/q+1/b22-21+ |
| InChIKey | PVVZPKPOGCJCNQ-QURGRASLSA-N |
| XLogP | 5.70 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.62 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|