About N,N-dibutyl-N'-ethylcarbamimidoyl chloride
N,N-dibutyl-N'-ethylcarbamimidoyl chloride (PubChem CID 121218469) has the molecular formula C11H23ClN2
and a molecular weight of 218.77 g/mol. Its IUPAC name is N,N-dibutyl-N'-ethylcarbamimidoyl chloride.
Molecular Properties
| Compound Name | N,N-dibutyl-N'-ethylcarbamimidoyl chloride |
| PubChem CID | 121218469 |
| Molecular Formula | C11H23ClN2 |
| Molecular Weight | 218.77 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | N,N-dibutyl-N'-ethylcarbamimidoyl chloride |
| SMILES | CCCCN(CCCC)/C(Cl)=N/CC |
| InChI | InChI=1S/C11H23ClN2/c1-4-7-9-14(10-8-5-2)11(12)13-6-3/h4-10H2,1-3H3/b13-11+ |
| InChIKey | QWJDZVAJIXVDCA-ACCUITESSA-N |
| XLogP | 3.50 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.77 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N,N-dibutyl-N'-ethylcarbamimidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibutyl-N'-ethylcarbamimidoyl chloride?
The IUPAC name of N,N-dibutyl-N'-ethylcarbamimidoyl chloride (CID 121218469) is N,N-dibutyl-N'-ethylcarbamimidoyl chloride.
What is the SMILES notation for N,N-dibutyl-N'-ethylcarbamimidoyl chloride?
The canonical SMILES for N,N-dibutyl-N'-ethylcarbamimidoyl chloride is CCCCN(CCCC)/C(Cl)=N/CC.
What is the InChIKey of N,N-dibutyl-N'-ethylcarbamimidoyl chloride?
The InChIKey is QWJDZVAJIXVDCA-ACCUITESSA-N. The full InChI is InChI=1S/C11H23ClN2/c1-4-7-9-14(10-8-5-2)11(12)13-6-3/h4-10H2,1-3H3/b13-11+.
What are the key properties of N,N-dibutyl-N'-ethylcarbamimidoyl chloride?
N,N-dibutyl-N'-ethylcarbamimidoyl chloride has a molecular weight of 218.77 g/mol, XLogP of 3.50, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibutyl-N'-ethylcarbamimidoyl chloride is sourced from PubChem (CID 121218469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).