C17H36N2 — CID 87295509
N,N,N'-tributylpentanimidamide (PubChem CID 87295509) has the molecular formula C17H36N2 and a molecular weight of 268.49 g/mol. Its IUPAC name is N,N,N'-tributylpentanimidamide.
| Compound Name | N,N,N'-tributylpentanimidamide |
|---|---|
| PubChem CID | 87295509 |
| Molecular Formula | C17H36N2 |
| Molecular Weight | 268.49 g/mol |
| Exact Mass | 268.29 |
| IUPAC Name | N,N,N'-tributylpentanimidamide |
| SMILES | CCCC/N=C(\CCCC)N(CCCC)CCCC |
| InChI | InChI=1S/C17H36N2/c1-5-9-13-17(18-14-10-6-2)19(15-11-7-3)16-12-8-4/h5-16H2,1-4H3/b18-17+ |
| InChIKey | ZPNZFHDWTVLFBS-ISLYRVAYSA-N |
| XLogP | 5.28 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.49 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|