About (Z)-4-amino-N-butyl-N'-(chloromethyl)-N-propylbut-3-enimidamide
(Z)-4-amino-N-butyl-N'-(chloromethyl)-N-propylbut-3-enimidamide (PubChem CID 143392999) has the molecular formula C12H24ClN3
and a molecular weight of 245.80 g/mol. Its IUPAC name is (Z)-4-amino-N-butyl-N'-(chloromethyl)-N-propylbut-3-enimidamide.
Molecular Properties
| Compound Name | (Z)-4-amino-N-butyl-N'-(chloromethyl)-N-propylbut-3-enimidamide |
| PubChem CID | 143392999 |
| Molecular Formula | C12H24ClN3 |
| Molecular Weight | 245.80 g/mol |
| Exact Mass | 245.17 |
| IUPAC Name | (Z)-4-amino-N-butyl-N'-(chloromethyl)-N-propylbut-3-enimidamide |
| SMILES | CCCCN(CCC)/C(C/C=C\N)=N/CCl |
| InChI | InChI=1S/C12H24ClN3/c1-3-5-10-16(9-4-2)12(15-11-13)7-6-8-14/h6,8H,3-5,7,9-11,14H2,1-2H3/b8-6-,15-12+ |
| InChIKey | FIDPEFDTCCOGRE-GMYGWMJXSA-N |
| XLogP | 2.96 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.80 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-amino-N-butyl-N'-(chloromethyl)-N-propylbut-3-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-amino-N-butyl-N'-(chloromethyl)-N-propylbut-3-enimidamide?
The IUPAC name of (Z)-4-amino-N-butyl-N'-(chloromethyl)-N-propylbut-3-enimidamide (CID 143392999) is (Z)-4-amino-N-butyl-N'-(chloromethyl)-N-propylbut-3-enimidamide.
What is the SMILES notation for (Z)-4-amino-N-butyl-N'-(chloromethyl)-N-propylbut-3-enimidamide?
The canonical SMILES for (Z)-4-amino-N-butyl-N'-(chloromethyl)-N-propylbut-3-enimidamide is CCCCN(CCC)/C(C/C=C\N)=N/CCl.
What is the InChIKey of (Z)-4-amino-N-butyl-N'-(chloromethyl)-N-propylbut-3-enimidamide?
The InChIKey is FIDPEFDTCCOGRE-GMYGWMJXSA-N. The full InChI is InChI=1S/C12H24ClN3/c1-3-5-10-16(9-4-2)12(15-11-13)7-6-8-14/h6,8H,3-5,7,9-11,14H2,1-2H3/b8-6-,15-12+.
What are the key properties of (Z)-4-amino-N-butyl-N'-(chloromethyl)-N-propylbut-3-enimidamide?
(Z)-4-amino-N-butyl-N'-(chloromethyl)-N-propylbut-3-enimidamide has a molecular weight of 245.80 g/mol, XLogP of 2.96, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-amino-N-butyl-N'-(chloromethyl)-N-propylbut-3-enimidamide is sourced from PubChem (CID 143392999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).