C14H33N5 — CID 163966516
2-[amino(butylamino)methyl]-1,1-dibutylguanidine (PubChem CID 163966516) has the molecular formula C14H33N5 and a molecular weight of 271.45 g/mol. Its IUPAC name is 2-[amino(butylamino)methyl]-1,1-dibutylguanidine.
| Compound Name | 2-[amino(butylamino)methyl]-1,1-dibutylguanidine |
|---|---|
| PubChem CID | 163966516 |
| Molecular Formula | C14H33N5 |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.27 |
| IUPAC Name | 2-[amino(butylamino)methyl]-1,1-dibutylguanidine |
| SMILES | CCCCNC(N)N=C(N)N(CCCC)CCCC |
| InChI | InChI=1S/C14H33N5/c1-4-7-10-17-13(15)18-14(16)19(11-8-5-2)12-9-6-3/h13,17H,4-12,15H2,1-3H3,(H2,16,18) |
| InChIKey | SMGNLKBBHPBUPF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|