C6H18N4 — CID 175179037
2-N'-butylethane-1,1,2,2-tetramine (PubChem CID 175179037) has the molecular formula C6H18N4 and a molecular weight of 146.24 g/mol. Its IUPAC name is 2-N'-butylethane-1,1,2,2-tetramine.
| Compound Name | 2-N'-butylethane-1,1,2,2-tetramine |
|---|---|
| PubChem CID | 175179037 |
| Molecular Formula | C6H18N4 |
| Molecular Weight | 146.24 g/mol |
| Exact Mass | 146.15 |
| IUPAC Name | 2-N'-butylethane-1,1,2,2-tetramine |
| SMILES | CCCCNC(N)C(N)N |
| InChI | InChI=1S/C6H18N4/c1-2-3-4-10-6(9)5(7)8/h5-6,10H,2-4,7-9H2,1H3 |
| InChIKey | LCWRUTCNNAIOQB-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.24 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|