C8H20N2 — CID 148852356
(2R)-3-N-butylbutane-2,3-diamine (PubChem CID 148852356) has the molecular formula C8H20N2 and a molecular weight of 144.26 g/mol. Its IUPAC name is (2R)-3-N-butylbutane-2,3-diamine.
| Compound Name | (2R)-3-N-butylbutane-2,3-diamine |
|---|---|
| PubChem CID | 148852356 |
| Molecular Formula | C8H20N2 |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.16 |
| IUPAC Name | (2R)-3-N-butylbutane-2,3-diamine |
| SMILES | CCCCNC(C)[C@@H](C)N |
| InChI | InChI=1S/C8H20N2/c1-4-5-6-10-8(3)7(2)9/h7-8,10H,4-6,9H2,1-3H3/t7-,8?/m1/s1 |
| InChIKey | OXRWBTJFNDNTRG-GVHYBUMESA-N |
| XLogP | 1.11 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|