About butylaminomethanedithiol
butylaminomethanedithiol (PubChem CID 25110747) has the molecular formula C5H13NS2
and a molecular weight of 151.30 g/mol. Its IUPAC name is butylaminomethanedithiol.
Molecular Properties
| Compound Name | butylaminomethanedithiol |
| PubChem CID | 25110747 |
| Molecular Formula | C5H13NS2 |
| Molecular Weight | 151.30 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | butylaminomethanedithiol |
| SMILES | CCCCNC(S)S |
| InChI | InChI=1S/C5H13NS2/c1-2-3-4-6-5(7)8/h5-8H,2-4H2,1H3 |
| InChIKey | KXEHJFTZASRNNF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze butylaminomethanedithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butylaminomethanedithiol?
The IUPAC name of butylaminomethanedithiol (CID 25110747) is butylaminomethanedithiol.
What is the SMILES notation for butylaminomethanedithiol?
The canonical SMILES for butylaminomethanedithiol is CCCCNC(S)S.
What is the InChIKey of butylaminomethanedithiol?
The InChIKey is KXEHJFTZASRNNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NS2/c1-2-3-4-6-5(7)8/h5-8H,2-4H2,1H3.
What are the key properties of butylaminomethanedithiol?
butylaminomethanedithiol has a molecular weight of 151.30 g/mol, XLogP of 1.52, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butylaminomethanedithiol is sourced from PubChem (CID 25110747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).