C10H26N2Si — CID 174173184
1-N,1-N'-dibutyl-2-silylethane-1,1-diamine (PubChem CID 174173184) has the molecular formula C10H26N2Si and a molecular weight of 202.42 g/mol. Its IUPAC name is 1-N,1-N'-dibutyl-2-silylethane-1,1-diamine.
| Compound Name | 1-N,1-N'-dibutyl-2-silylethane-1,1-diamine |
|---|---|
| PubChem CID | 174173184 |
| Molecular Formula | C10H26N2Si |
| Molecular Weight | 202.42 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | 1-N,1-N'-dibutyl-2-silylethane-1,1-diamine |
| SMILES | CCCCNC(C[SiH3])NCCCC |
| InChI | InChI=1S/C10H26N2Si/c1-3-5-7-11-10(9-13)12-8-6-4-2/h10-12H,3-9H2,1-2,13H3 |
| InChIKey | PWMPNMZIZUPKIG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.42 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|