About 1-(butylamino)ethanol;hydrochloride
1-(butylamino)ethanol;hydrochloride (PubChem CID 20534159) has the molecular formula C6H16ClNO
and a molecular weight of 153.65 g/mol. Its IUPAC name is 1-(butylamino)ethanol;hydrochloride.
Molecular Properties
| Compound Name | 1-(butylamino)ethanol;hydrochloride |
| PubChem CID | 20534159 |
| Molecular Formula | C6H16ClNO |
| Molecular Weight | 153.65 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | 1-(butylamino)ethanol;hydrochloride |
| SMILES | CCCCNC(C)O.Cl |
| InChI | InChI=1S/C6H15NO.ClH/c1-3-4-5-7-6(2)8;/h6-8H,3-5H2,1-2H3;1H |
| InChIKey | AUXBHTYZRWYEPL-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.65 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(butylamino)ethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(butylamino)ethanol;hydrochloride?
The IUPAC name of 1-(butylamino)ethanol;hydrochloride (CID 20534159) is 1-(butylamino)ethanol;hydrochloride.
What is the SMILES notation for 1-(butylamino)ethanol;hydrochloride?
The canonical SMILES for 1-(butylamino)ethanol;hydrochloride is CCCCNC(C)O.Cl.
What is the InChIKey of 1-(butylamino)ethanol;hydrochloride?
The InChIKey is AUXBHTYZRWYEPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO.ClH/c1-3-4-5-7-6(2)8;/h6-8H,3-5H2,1-2H3;1H.
What are the key properties of 1-(butylamino)ethanol;hydrochloride?
1-(butylamino)ethanol;hydrochloride has a molecular weight of 153.65 g/mol, XLogP of 1.14, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(butylamino)ethanol;hydrochloride is sourced from PubChem (CID 20534159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).