About (3Z)-3-amino-N,N-dibutyl-3-hydroxyiminopropanamide
(3Z)-3-amino-N,N-dibutyl-3-hydroxyiminopropanamide (PubChem CID 43155922) has the molecular formula C11H23N3O2
and a molecular weight of 229.32 g/mol. Its IUPAC name is (3Z)-3-amino-N,N-dibutyl-3-hydroxyiminopropanamide.
Molecular Properties
| Compound Name | (3Z)-3-amino-N,N-dibutyl-3-hydroxyiminopropanamide |
| PubChem CID | 43155922 |
| Molecular Formula | C11H23N3O2 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | (3Z)-3-amino-N,N-dibutyl-3-hydroxyiminopropanamide |
| SMILES | CCCCN(CCCC)C(=O)C/C(N)=N/O |
| InChI | InChI=1S/C11H23N3O2/c1-3-5-7-14(8-6-4-2)11(15)9-10(12)13-16/h16H,3-9H2,1-2H3,(H2,12,13) |
| InChIKey | CICVYFQNUIVJIQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-amino-N,N-dibutyl-3-hydroxyiminopropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-amino-N,N-dibutyl-3-hydroxyiminopropanamide?
The IUPAC name of (3Z)-3-amino-N,N-dibutyl-3-hydroxyiminopropanamide (CID 43155922) is (3Z)-3-amino-N,N-dibutyl-3-hydroxyiminopropanamide.
What is the SMILES notation for (3Z)-3-amino-N,N-dibutyl-3-hydroxyiminopropanamide?
The canonical SMILES for (3Z)-3-amino-N,N-dibutyl-3-hydroxyiminopropanamide is CCCCN(CCCC)C(=O)C/C(N)=N/O.
What is the InChIKey of (3Z)-3-amino-N,N-dibutyl-3-hydroxyiminopropanamide?
The InChIKey is CICVYFQNUIVJIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3O2/c1-3-5-7-14(8-6-4-2)11(15)9-10(12)13-16/h16H,3-9H2,1-2H3,(H2,12,13).
What are the key properties of (3Z)-3-amino-N,N-dibutyl-3-hydroxyiminopropanamide?
(3Z)-3-amino-N,N-dibutyl-3-hydroxyiminopropanamide has a molecular weight of 229.32 g/mol, XLogP of 1.55, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-amino-N,N-dibutyl-3-hydroxyiminopropanamide is sourced from PubChem (CID 43155922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).