About N'-ethyl-N'-hexylpropanediamide
N'-ethyl-N'-hexylpropanediamide (PubChem CID 174895850) has the molecular formula C11H22N2O2
and a molecular weight of 214.31 g/mol. Its IUPAC name is N'-ethyl-N'-hexylpropanediamide.
Molecular Properties
| Compound Name | N'-ethyl-N'-hexylpropanediamide |
| PubChem CID | 174895850 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | N'-ethyl-N'-hexylpropanediamide |
| SMILES | CCCCCCN(CC)C(=O)CC(N)=O |
| InChI | InChI=1S/C11H22N2O2/c1-3-5-6-7-8-13(4-2)11(15)9-10(12)14/h3-9H2,1-2H3,(H2,12,14) |
| InChIKey | CIGXRTXJWAHSFZ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N'-ethyl-N'-hexylpropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-N'-hexylpropanediamide?
The IUPAC name of N'-ethyl-N'-hexylpropanediamide (CID 174895850) is N'-ethyl-N'-hexylpropanediamide.
What is the SMILES notation for N'-ethyl-N'-hexylpropanediamide?
The canonical SMILES for N'-ethyl-N'-hexylpropanediamide is CCCCCCN(CC)C(=O)CC(N)=O.
What is the InChIKey of N'-ethyl-N'-hexylpropanediamide?
The InChIKey is CIGXRTXJWAHSFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O2/c1-3-5-6-7-8-13(4-2)11(15)9-10(12)14/h3-9H2,1-2H3,(H2,12,14).
What are the key properties of N'-ethyl-N'-hexylpropanediamide?
N'-ethyl-N'-hexylpropanediamide has a molecular weight of 214.31 g/mol, XLogP of 1.29, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-N'-hexylpropanediamide is sourced from PubChem (CID 174895850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).