About N-ethyl-N-hexylcarbamate
N-ethyl-N-hexylcarbamate (PubChem CID 53442022) has the molecular formula C9H18NO2-
and a molecular weight of 172.25 g/mol. Its IUPAC name is N-ethyl-N-hexylcarbamate.
Molecular Properties
| Compound Name | N-ethyl-N-hexylcarbamate |
| PubChem CID | 53442022 |
| Molecular Formula | C9H18NO2- |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | N-ethyl-N-hexylcarbamate |
| SMILES | CCCCCCN(CC)C(=O)[O-] |
| InChI | InChI=1S/C9H19NO2/c1-3-5-6-7-8-10(4-2)9(11)12/h3-8H2,1-2H3,(H,11,12)/p-1 |
| InChIKey | YUCBRFCXEBQDQU-UHFFFAOYSA-M |
| XLogP | 1.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-hexylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-hexylcarbamate?
The IUPAC name of N-ethyl-N-hexylcarbamate (CID 53442022) is N-ethyl-N-hexylcarbamate.
What is the SMILES notation for N-ethyl-N-hexylcarbamate?
The canonical SMILES for N-ethyl-N-hexylcarbamate is CCCCCCN(CC)C(=O)[O-].
What is the InChIKey of N-ethyl-N-hexylcarbamate?
The InChIKey is YUCBRFCXEBQDQU-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H19NO2/c1-3-5-6-7-8-10(4-2)9(11)12/h3-8H2,1-2H3,(H,11,12)/p-1.
What are the key properties of N-ethyl-N-hexylcarbamate?
N-ethyl-N-hexylcarbamate has a molecular weight of 172.25 g/mol, XLogP of 1.23, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-hexylcarbamate is sourced from PubChem (CID 53442022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).