C16H35N5 — CID 143670649
2-[6-[butyl(propyl)amino]-5-(methylamino)hept-6-enyl]guanidine (PubChem CID 143670649) has the molecular formula C16H35N5 and a molecular weight of 297.49 g/mol. Its IUPAC name is 2-[6-[butyl(propyl)amino]-5-(methylamino)hept-6-enyl]guanidine.
| Compound Name | 2-[6-[butyl(propyl)amino]-5-(methylamino)hept-6-enyl]guanidine |
|---|---|
| PubChem CID | 143670649 |
| Molecular Formula | C16H35N5 |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.29 |
| IUPAC Name | 2-[6-[butyl(propyl)amino]-5-(methylamino)hept-6-enyl]guanidine |
| SMILES | C=C(C(CCCCN=C(N)N)NC)N(CCC)CCCC |
| InChI | InChI=1S/C16H35N5/c1-5-7-13-21(12-6-2)14(3)15(19-4)10-8-9-11-20-16(17)18/h15,19H,3,5-13H2,1-2,4H3,(H4,17,18,20) |
| InChIKey | NHYGUJXRTWMYLC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|