C13H26N6O4S — CID 88987231
(2S)-5-(diaminomethylideneamino)-2-[[2-[propyl-[2-(sulfanylamino)acetyl]amino]acetyl]amino]pentanoic acid (PubChem CID 88987231) has the molecular formula C13H26N6O4S and a molecular weight of 362.46 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[2-[propyl-[2-(sulfanylamino)acetyl]amino]acetyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[2-[propyl-[2-(sulfanylamino)acetyl]amino]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 88987231 |
| Molecular Formula | C13H26N6O4S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[2-[propyl-[2-(sulfanylamino)acetyl]amino]acetyl]amino]pentanoic acid |
| SMILES | CCCN(CC(=O)N[C@@H](CCCN=C(N)N)C(=O)O)C(=O)CNS |
| InChI | InChI=1S/C13H26N6O4S/c1-2-6-19(11(21)7-17-24)8-10(20)18-9(12(22)23)4-3-5-16-13(14)15/h9,17,24H,2-8H2,1H3,(H,18,20)(H,22,23)(H4,14,15,16)/t9-/m0/s1 |
| InChIKey | XBTFADQCHKJFDB-VIFPVBQESA-N |
| XLogP | -1.72 |
| TPSA | 163.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|