C12H24ClN — CID 64681695
(E)-N,N-dibutyl-4-chlorobut-2-en-1-amine (PubChem CID 64681695) has the molecular formula C12H24ClN and a molecular weight of 217.78 g/mol. Its IUPAC name is (E)-N,N-dibutyl-4-chlorobut-2-en-1-amine.
| Compound Name | (E)-N,N-dibutyl-4-chlorobut-2-en-1-amine |
|---|---|
| PubChem CID | 64681695 |
| Molecular Formula | C12H24ClN |
| Molecular Weight | 217.78 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | (E)-N,N-dibutyl-4-chlorobut-2-en-1-amine |
| SMILES | CCCCN(C/C=C/CCl)CCCC |
| InChI | InChI=1S/C12H24ClN/c1-3-5-10-14(11-6-4-2)12-8-7-9-13/h7-8H,3-6,9-12H2,1-2H3/b8-7+ |
| InChIKey | XTCQDEYSZCXITJ-BQYQJAHWSA-N |
| XLogP | 3.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.78 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|