C13H26LiN — CID 90302197
lithium (Z)-N,N-dibutyl-3-methanidylbut-2-en-1-amine (PubChem CID 90302197) has the molecular formula C13H26LiN and a molecular weight of 203.30 g/mol. Its IUPAC name is lithium (Z)-N,N-dibutyl-3-methanidylbut-2-en-1-amine.
| Compound Name | lithium (Z)-N,N-dibutyl-3-methanidylbut-2-en-1-amine |
|---|---|
| PubChem CID | 90302197 |
| Molecular Formula | C13H26LiN |
| Molecular Weight | 203.30 g/mol |
| Exact Mass | 203.22 |
| IUPAC Name | lithium (Z)-N,N-dibutyl-3-methanidylbut-2-en-1-amine |
| SMILES | [CH2-]/C(C)=C/CN(CCCC)CCCC.[Li+] |
| InChI | InChI=1S/C13H26N.Li/c1-5-7-10-14(11-8-6-2)12-9-13(3)4;/h9H,3,5-8,10-12H2,1-2,4H3;/q-1;+1/b13-9-; |
| InChIKey | VECTXNXUXXAPTQ-CHHCPSLASA-N |
| XLogP | 0.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|