C16H31N — CID 5043810
N,N-dibutylocta-2,7-dien-1-amine (PubChem CID 5043810) has the molecular formula C16H31N and a molecular weight of 237.43 g/mol. Its IUPAC name is N,N-dibutylocta-2,7-dien-1-amine.
| Compound Name | N,N-dibutylocta-2,7-dien-1-amine |
|---|---|
| PubChem CID | 5043810 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | N,N-dibutylocta-2,7-dien-1-amine |
| SMILES | C=CCCCC=CCN(CCCC)CCCC |
| InChI | InChI=1S/C16H31N/c1-4-7-10-11-12-13-16-17(14-8-5-2)15-9-6-3/h4,12-13H,1,5-11,14-16H2,2-3H3 |
| InChIKey | BHAGAKHTNSWRIV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|