C22H39N — CID 142769563
N-butyl-N-nona-2,8-dienylnona-2,8-dien-1-amine (PubChem CID 142769563) has the molecular formula C22H39N and a molecular weight of 317.56 g/mol. Its IUPAC name is N-butyl-N-nona-2,8-dienylnona-2,8-dien-1-amine.
| Compound Name | N-butyl-N-nona-2,8-dienylnona-2,8-dien-1-amine |
|---|---|
| PubChem CID | 142769563 |
| Molecular Formula | C22H39N |
| Molecular Weight | 317.56 g/mol |
| Exact Mass | 317.31 |
| IUPAC Name | N-butyl-N-nona-2,8-dienylnona-2,8-dien-1-amine |
| SMILES | C=CCCCCC=CCN(CC=CCCCCC=C)CCCC |
| InChI | InChI=1S/C22H39N/c1-4-7-10-12-14-16-18-21-23(20-9-6-3)22-19-17-15-13-11-8-5-2/h4-5,16-19H,1-2,6-15,20-22H2,3H3 |
| InChIKey | WNJBCHGTFBTHKQ-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.56 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|