About triethyl-(N'-ethyl-N,N-dipentylcarbamimidoyl)azanium chloride
triethyl-(N'-ethyl-N,N-dipentylcarbamimidoyl)azanium chloride (PubChem CID 163212740) has the molecular formula C19H42ClN3
and a molecular weight of 348.02 g/mol. Its IUPAC name is triethyl-(N'-ethyl-N,N-dipentylcarbamimidoyl)azanium chloride.
Molecular Properties
| Compound Name | triethyl-(N'-ethyl-N,N-dipentylcarbamimidoyl)azanium chloride |
| PubChem CID | 163212740 |
| Molecular Formula | C19H42ClN3 |
| Molecular Weight | 348.02 g/mol |
| Exact Mass | 347.31 |
| IUPAC Name | triethyl-(N'-ethyl-N,N-dipentylcarbamimidoyl)azanium chloride |
| SMILES | CCCCCN(CCCCC)/C(=N\CC)[N+](CC)(CC)CC.[Cl-] |
| InChI | InChI=1S/C19H42N3.ClH/c1-7-13-15-17-21(18-16-14-8-2)19(20-9-3)22(10-4,11-5)12-6;/h7-18H2,1-6H3;1H/q+1;/p-1/b20-19+; |
| InChIKey | OJVZZWSYNFLSCA-RZLHGTIFSA-M |
| XLogP | 1.93 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.02 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze triethyl-(N'-ethyl-N,N-dipentylcarbamimidoyl)azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-(N'-ethyl-N,N-dipentylcarbamimidoyl)azanium chloride?
The IUPAC name of triethyl-(N'-ethyl-N,N-dipentylcarbamimidoyl)azanium chloride (CID 163212740) is triethyl-(N'-ethyl-N,N-dipentylcarbamimidoyl)azanium chloride.
What is the SMILES notation for triethyl-(N'-ethyl-N,N-dipentylcarbamimidoyl)azanium chloride?
The canonical SMILES for triethyl-(N'-ethyl-N,N-dipentylcarbamimidoyl)azanium chloride is CCCCCN(CCCCC)/C(=N\CC)[N+](CC)(CC)CC.[Cl-].
What is the InChIKey of triethyl-(N'-ethyl-N,N-dipentylcarbamimidoyl)azanium chloride?
The InChIKey is OJVZZWSYNFLSCA-RZLHGTIFSA-M. The full InChI is InChI=1S/C19H42N3.ClH/c1-7-13-15-17-21(18-16-14-8-2)19(20-9-3)22(10-4,11-5)12-6;/h7-18H2,1-6H3;1H/q+1;/p-1/b20-19+;.
What are the key properties of triethyl-(N'-ethyl-N,N-dipentylcarbamimidoyl)azanium chloride?
triethyl-(N'-ethyl-N,N-dipentylcarbamimidoyl)azanium chloride has a molecular weight of 348.02 g/mol, XLogP of 1.93, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-(N'-ethyl-N,N-dipentylcarbamimidoyl)azanium chloride is sourced from PubChem (CID 163212740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).