C15H34ClN3 — CID 163212742
triethyl-(N'-ethyl-N,N-dipropylcarbamimidoyl)azanium chloride (PubChem CID 163212742) has the molecular formula C15H34ClN3 and a molecular weight of 291.91 g/mol. Its IUPAC name is triethyl-(N'-ethyl-N,N-dipropylcarbamimidoyl)azanium chloride.
| Compound Name | triethyl-(N'-ethyl-N,N-dipropylcarbamimidoyl)azanium chloride |
|---|---|
| PubChem CID | 163212742 |
| Molecular Formula | C15H34ClN3 |
| Molecular Weight | 291.91 g/mol |
| Exact Mass | 291.24 |
| IUPAC Name | triethyl-(N'-ethyl-N,N-dipropylcarbamimidoyl)azanium chloride |
| SMILES | CCCN(CCC)/C(=N\CC)[N+](CC)(CC)CC.[Cl-] |
| InChI | InChI=1S/C15H34N3.ClH/c1-7-13-17(14-8-2)15(16-9-3)18(10-4,11-5)12-6;/h7-14H2,1-6H3;1H/q+1;/p-1/b16-15+; |
| InChIKey | VRAZOSSLJBQVRV-GEEYTBSJSA-M |
| XLogP | 0.36 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.91 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|