C9H21ClN2 — CID 88610819
N'-ethyl-N,N-dipropylmethanimidamide;hydrochloride (PubChem CID 88610819) has the molecular formula C9H21ClN2 and a molecular weight of 192.73 g/mol. Its IUPAC name is N'-ethyl-N,N-dipropylmethanimidamide;hydrochloride.
| Compound Name | N'-ethyl-N,N-dipropylmethanimidamide;hydrochloride |
|---|---|
| PubChem CID | 88610819 |
| Molecular Formula | C9H21ClN2 |
| Molecular Weight | 192.73 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | N'-ethyl-N,N-dipropylmethanimidamide;hydrochloride |
| SMILES | CCCN(/C=N/CC)CCC.Cl |
| InChI | InChI=1S/C9H20N2.ClH/c1-4-7-11(8-5-2)9-10-6-3;/h9H,4-8H2,1-3H3;1H/b10-9+; |
| InChIKey | VYSHDGGNLQUARJ-RRABGKBLSA-N |
| XLogP | 2.58 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.73 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|