About N'-(dimethoxymethyl)-N,N-dipropylmethanimidamide
N'-(dimethoxymethyl)-N,N-dipropylmethanimidamide (PubChem CID 71334378) has the molecular formula C10H22N2O2
and a molecular weight of 202.30 g/mol. Its IUPAC name is N'-(dimethoxymethyl)-N,N-dipropylmethanimidamide.
Molecular Properties
| Compound Name | N'-(dimethoxymethyl)-N,N-dipropylmethanimidamide |
| PubChem CID | 71334378 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | N'-(dimethoxymethyl)-N,N-dipropylmethanimidamide |
| SMILES | CCCN(C=NC(OC)OC)CCC |
| InChI | InChI=1S/C10H22N2O2/c1-5-7-12(8-6-2)9-11-10(13-3)14-4/h9-10H,5-8H2,1-4H3 |
| InChIKey | ZYRFYRCINWVTOV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(dimethoxymethyl)-N,N-dipropylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(dimethoxymethyl)-N,N-dipropylmethanimidamide?
The IUPAC name of N'-(dimethoxymethyl)-N,N-dipropylmethanimidamide (CID 71334378) is N'-(dimethoxymethyl)-N,N-dipropylmethanimidamide.
What is the SMILES notation for N'-(dimethoxymethyl)-N,N-dipropylmethanimidamide?
The canonical SMILES for N'-(dimethoxymethyl)-N,N-dipropylmethanimidamide is CCCN(C=NC(OC)OC)CCC.
What is the InChIKey of N'-(dimethoxymethyl)-N,N-dipropylmethanimidamide?
The InChIKey is ZYRFYRCINWVTOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O2/c1-5-7-12(8-6-2)9-11-10(13-3)14-4/h9-10H,5-8H2,1-4H3.
What are the key properties of N'-(dimethoxymethyl)-N,N-dipropylmethanimidamide?
N'-(dimethoxymethyl)-N,N-dipropylmethanimidamide has a molecular weight of 202.30 g/mol, XLogP of 1.71, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(dimethoxymethyl)-N,N-dipropylmethanimidamide is sourced from PubChem (CID 71334378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).