About methanesulfonate;triethyl-(N,N,N'-triethylcarbamimidoyl)azanium
methanesulfonate;triethyl-(N,N,N'-triethylcarbamimidoyl)azanium (PubChem CID 87085879) has the molecular formula C14H33N3O3S
and a molecular weight of 323.50 g/mol. Its IUPAC name is methanesulfonate;triethyl-(N,N,N'-triethylcarbamimidoyl)azanium.
Molecular Properties
| Compound Name | methanesulfonate;triethyl-(N,N,N'-triethylcarbamimidoyl)azanium |
| PubChem CID | 87085879 |
| Molecular Formula | C14H33N3O3S |
| Molecular Weight | 323.50 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | methanesulfonate;triethyl-(N,N,N'-triethylcarbamimidoyl)azanium |
| SMILES | CC/N=C(\N(CC)CC)[N+](CC)(CC)CC.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C13H30N3.CH4O3S/c1-7-14-13(15(8-2)9-3)16(10-4,11-5)12-6;1-5(2,3)4/h7-12H2,1-6H3;1H3,(H,2,3,4)/q+1;/p-1/b14-13+; |
| InChIKey | RIXYDYYRHAICBR-IERUDJENSA-M |
| XLogP | 1.74 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.50 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonate;triethyl-(N,N,N'-triethylcarbamimidoyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonate;triethyl-(N,N,N'-triethylcarbamimidoyl)azanium?
The IUPAC name of methanesulfonate;triethyl-(N,N,N'-triethylcarbamimidoyl)azanium (CID 87085879) is methanesulfonate;triethyl-(N,N,N'-triethylcarbamimidoyl)azanium.
What is the SMILES notation for methanesulfonate;triethyl-(N,N,N'-triethylcarbamimidoyl)azanium?
The canonical SMILES for methanesulfonate;triethyl-(N,N,N'-triethylcarbamimidoyl)azanium is CC/N=C(\N(CC)CC)[N+](CC)(CC)CC.CS(=O)(=O)[O-].
What is the InChIKey of methanesulfonate;triethyl-(N,N,N'-triethylcarbamimidoyl)azanium?
The InChIKey is RIXYDYYRHAICBR-IERUDJENSA-M. The full InChI is InChI=1S/C13H30N3.CH4O3S/c1-7-14-13(15(8-2)9-3)16(10-4,11-5)12-6;1-5(2,3)4/h7-12H2,1-6H3;1H3,(H,2,3,4)/q+1;/p-1/b14-13+;.
What are the key properties of methanesulfonate;triethyl-(N,N,N'-triethylcarbamimidoyl)azanium?
methanesulfonate;triethyl-(N,N,N'-triethylcarbamimidoyl)azanium has a molecular weight of 323.50 g/mol, XLogP of 1.74, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonate;triethyl-(N,N,N'-triethylcarbamimidoyl)azanium is sourced from PubChem (CID 87085879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).