C14H33N3O3S — CID 87085879
methanesulfonate;triethyl-(N,N,N'-triethylcarbamimidoyl)azanium (PubChem CID 87085879) has the molecular formula C14H33N3O3S and a molecular weight of 323.50 g/mol. Its IUPAC name is methanesulfonate;triethyl-(N,N,N'-triethylcarbamimidoyl)azanium.
| Compound Name | methanesulfonate;triethyl-(N,N,N'-triethylcarbamimidoyl)azanium |
|---|---|
| PubChem CID | 87085879 |
| Molecular Formula | C14H33N3O3S |
| Molecular Weight | 323.50 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | methanesulfonate;triethyl-(N,N,N'-triethylcarbamimidoyl)azanium |
| SMILES | CC/N=C(\N(CC)CC)[N+](CC)(CC)CC.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C13H30N3.CH4O3S/c1-7-14-13(15(8-2)9-3)16(10-4,11-5)12-6;1-5(2,3)4/h7-12H2,1-6H3;1H3,(H,2,3,4)/q+1;/p-1/b14-13+; |
| InChIKey | RIXYDYYRHAICBR-IERUDJENSA-M |
| XLogP | 1.74 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.50 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|