About methanesulfonate;propanoate
methanesulfonate;propanoate (PubChem CID 20534691) has the molecular formula C4H8O5S-2
and a molecular weight of 168.17 g/mol. Its IUPAC name is methanesulfonate;propanoate.
Molecular Properties
| Compound Name | methanesulfonate;propanoate |
| PubChem CID | 20534691 |
| Molecular Formula | C4H8O5S-2 |
| Molecular Weight | 168.17 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | methanesulfonate;propanoate |
| SMILES | CCC(=O)[O-].CS(=O)(=O)[O-] |
| InChI | InChI=1S/C3H6O2.CH4O3S/c1-2-3(4)5;1-5(2,3)4/h2H2,1H3,(H,4,5);1H3,(H,2,3,4)/p-2 |
| InChIKey | UANOJLOYSTZABR-UHFFFAOYSA-L |
| XLogP | -1.69 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.17 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonate;propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonate;propanoate?
The IUPAC name of methanesulfonate;propanoate (CID 20534691) is methanesulfonate;propanoate.
What is the SMILES notation for methanesulfonate;propanoate?
The canonical SMILES for methanesulfonate;propanoate is CCC(=O)[O-].CS(=O)(=O)[O-].
What is the InChIKey of methanesulfonate;propanoate?
The InChIKey is UANOJLOYSTZABR-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H6O2.CH4O3S/c1-2-3(4)5;1-5(2,3)4/h2H2,1H3,(H,4,5);1H3,(H,2,3,4)/p-2.
What are the key properties of methanesulfonate;propanoate?
methanesulfonate;propanoate has a molecular weight of 168.17 g/mol, XLogP of -1.69, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonate;propanoate is sourced from PubChem (CID 20534691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).