C8H19NO5S — CID 161394342
2-carboxyethyl-ethyl-dimethylazanium;methanesulfonate (PubChem CID 161394342) has the molecular formula C8H19NO5S and a molecular weight of 241.31 g/mol. Its IUPAC name is 2-carboxyethyl-ethyl-dimethylazanium;methanesulfonate.
| Compound Name | 2-carboxyethyl-ethyl-dimethylazanium;methanesulfonate |
|---|---|
| PubChem CID | 161394342 |
| Molecular Formula | C8H19NO5S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 2-carboxyethyl-ethyl-dimethylazanium;methanesulfonate |
| SMILES | CC[N+](C)(C)CCC(=O)O.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C7H15NO2.CH4O3S/c1-4-8(2,3)6-5-7(9)10;1-5(2,3)4/h4-6H2,1-3H3;1H3,(H,2,3,4) |
| InChIKey | PHLVZQYFADYYPC-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|