C18H36N2O10S — CID 175249815
bis(2-carboxyethyl-(2-hydroxyethyl)-methyl-prop-2-enylazanium);sulfate (PubChem CID 175249815) has the molecular formula C18H36N2O10S and a molecular weight of 472.56 g/mol. Its IUPAC name is bis(2-carboxyethyl-(2-hydroxyethyl)-methyl-prop-2-enylazanium);sulfate.
| Compound Name | bis(2-carboxyethyl-(2-hydroxyethyl)-methyl-prop-2-enylazanium);sulfate |
|---|---|
| PubChem CID | 175249815 |
| Molecular Formula | C18H36N2O10S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | bis(2-carboxyethyl-(2-hydroxyethyl)-methyl-prop-2-enylazanium);sulfate |
| SMILES | C=CC[N+](C)(CCO)CCC(=O)O.C=CC[N+](C)(CCO)CCC(=O)O.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C9H17NO3.H2O4S/c2*1-3-5-10(2,7-8-11)6-4-9(12)13;1-5(2,3)4/h2*3,11H,1,4-8H2,2H3;(H2,1,2,3,4) |
| InChIKey | IGRCDUOBLUWLRO-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 195.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|