C10H20NO6+ — CID 126615249
bis(2-carboxyethyl)-bis(2-hydroxyethyl)azanium (PubChem CID 126615249) has the molecular formula C10H20NO6+ and a molecular weight of 250.27 g/mol. Its IUPAC name is bis(2-carboxyethyl)-bis(2-hydroxyethyl)azanium.
| Compound Name | bis(2-carboxyethyl)-bis(2-hydroxyethyl)azanium |
|---|---|
| PubChem CID | 126615249 |
| Molecular Formula | C10H20NO6+ |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | bis(2-carboxyethyl)-bis(2-hydroxyethyl)azanium |
| SMILES | O=C(O)CC[N+](CCO)(CCO)CCC(=O)O |
| InChI | InChI=1S/C10H19NO6/c12-7-5-11(6-8-13,3-1-9(14)15)4-2-10(16)17/h12-13H,1-8H2,(H-,14,15,16,17)/p+1 |
| InChIKey | WIPRMMZVKNHQQO-UHFFFAOYSA-O |
| XLogP | -1.26 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|