C32H58CaN2O10+2 — CID 101281806
calcium bis(3-[2-carboxyethyl-(2-hydroxyethyl)-[(E)-oct-4-enyl]azaniumyl]propanoate) (PubChem CID 101281806) has the molecular formula C32H58CaN2O10+2 and a molecular weight of 670.90 g/mol. Its IUPAC name is calcium bis(3-[2-carboxyethyl-(2-hydroxyethyl)-[(E)-oct-4-enyl]azaniumyl]propanoate).
| Compound Name | calcium bis(3-[2-carboxyethyl-(2-hydroxyethyl)-[(E)-oct-4-enyl]azaniumyl]propanoate) |
|---|---|
| PubChem CID | 101281806 |
| Molecular Formula | C32H58CaN2O10+2 |
| Molecular Weight | 670.90 g/mol |
| Exact Mass | 670.37 |
| IUPAC Name | calcium bis(3-[2-carboxyethyl-(2-hydroxyethyl)-[(E)-oct-4-enyl]azaniumyl]propanoate) |
| SMILES | CCC/C=C/CCC[N+](CCO)(CCC(=O)[O-])CCC(=O)O.CCC/C=C/CCC[N+](CCO)(CCC(=O)[O-])CCC(=O)O.[Ca+2] |
| InChI | InChI=1S/2C16H29NO5.Ca/c2*1-2-3-4-5-6-7-10-17(13-14-18,11-8-15(19)20)12-9-16(21)22;/h2*4-5,18H,2-3,6-14H2,1H3,(H-,19,20,21,22);/q;;+2/b2*5-4+; |
| InChIKey | GLRMUZVEPCHLGS-WDTNTSJCSA-N |
| XLogP | 0.71 |
| TPSA | 195.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.90 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|