C18H33KNO5+ — CID 101281989
potassium 4-[3-carboxypropyl-(2-hydroxyethyl)-[(E)-oct-5-enyl]azaniumyl]butanoate (PubChem CID 101281989) has the molecular formula C18H33KNO5+ and a molecular weight of 382.56 g/mol. Its IUPAC name is potassium 4-[3-carboxypropyl-(2-hydroxyethyl)-[(E)-oct-5-enyl]azaniumyl]butanoate.
| Compound Name | potassium 4-[3-carboxypropyl-(2-hydroxyethyl)-[(E)-oct-5-enyl]azaniumyl]butanoate |
|---|---|
| PubChem CID | 101281989 |
| Molecular Formula | C18H33KNO5+ |
| Molecular Weight | 382.56 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | potassium 4-[3-carboxypropyl-(2-hydroxyethyl)-[(E)-oct-5-enyl]azaniumyl]butanoate |
| SMILES | CC/C=C/CCCC[N+](CCO)(CCCC(=O)[O-])CCCC(=O)O.[K+] |
| InChI | InChI=1S/C18H33NO5.K/c1-2-3-4-5-6-7-12-19(15-16-20,13-8-10-17(21)22)14-9-11-18(23)24;/h3-4,20H,2,5-16H2,1H3,(H-,21,22,23,24);/q;+1/b4-3+; |
| InChIKey | XBUKNGLHUCTYFE-BJILWQEISA-N |
| XLogP | -1.67 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.56 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|