C23H41NO6 — CID 177469710
3-[bis(2-carboxyethyl)-[(E)-tetradec-4-enyl]azaniumyl]propanoate (PubChem CID 177469710) has the molecular formula C23H41NO6 and a molecular weight of 427.58 g/mol. Its IUPAC name is 3-[bis(2-carboxyethyl)-[(E)-tetradec-4-enyl]azaniumyl]propanoate.
| Compound Name | 3-[bis(2-carboxyethyl)-[(E)-tetradec-4-enyl]azaniumyl]propanoate |
|---|---|
| PubChem CID | 177469710 |
| Molecular Formula | C23H41NO6 |
| Molecular Weight | 427.58 g/mol |
| Exact Mass | 427.29 |
| IUPAC Name | 3-[bis(2-carboxyethyl)-[(E)-tetradec-4-enyl]azaniumyl]propanoate |
| SMILES | CCCCCCCCC/C=C/CCC[N+](CCC(=O)[O-])(CCC(=O)O)CCC(=O)O |
| InChI | InChI=1S/C23H41NO6/c1-2-3-4-5-6-7-8-9-10-11-12-13-17-24(18-14-21(25)26,19-15-22(27)28)20-16-23(29)30/h10-11H,2-9,12-20H2,1H3,(H2-,25,26,27,28,29,30)/b11-10+ |
| InChIKey | HEOBFZCYAKNYJC-ZHACJKMWSA-N |
| XLogP | 3.37 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.58 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|