C17H31NNaO5+ — CID 101281897
sodium 4-[3-carboxypropyl-(hydroxymethyl)-[(E)-oct-4-enyl]azaniumyl]butanoate (PubChem CID 101281897) has the molecular formula C17H31NNaO5+ and a molecular weight of 352.43 g/mol. Its IUPAC name is sodium 4-[3-carboxypropyl-(hydroxymethyl)-[(E)-oct-4-enyl]azaniumyl]butanoate.
| Compound Name | sodium 4-[3-carboxypropyl-(hydroxymethyl)-[(E)-oct-4-enyl]azaniumyl]butanoate |
|---|---|
| PubChem CID | 101281897 |
| Molecular Formula | C17H31NNaO5+ |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | sodium 4-[3-carboxypropyl-(hydroxymethyl)-[(E)-oct-4-enyl]azaniumyl]butanoate |
| SMILES | CCC/C=C/CCC[N+](CO)(CCCC(=O)[O-])CCCC(=O)O.[Na+] |
| InChI | InChI=1S/C17H31NO5.Na/c1-2-3-4-5-6-7-12-18(15-19,13-8-10-16(20)21)14-9-11-17(22)23;/h4-5,19H,2-3,6-15H2,1H3,(H-,20,21,22,23);/q;+1/b5-4+; |
| InChIKey | ZNFJICOMNFFYQH-FXRZFVDSSA-N |
| XLogP | -1.71 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|