C17H30KN2O6+ — CID 101280695
potassium 3-[2-carboxyethyl-[2-(hept-6-enoylamino)ethyl]-(2-hydroxyethyl)azaniumyl]propanoate (PubChem CID 101280695) has the molecular formula C17H30KN2O6+ and a molecular weight of 397.53 g/mol. Its IUPAC name is potassium 3-[2-carboxyethyl-[2-(hept-6-enoylamino)ethyl]-(2-hydroxyethyl)azaniumyl]propanoate.
| Compound Name | potassium 3-[2-carboxyethyl-[2-(hept-6-enoylamino)ethyl]-(2-hydroxyethyl)azaniumyl]propanoate |
|---|---|
| PubChem CID | 101280695 |
| Molecular Formula | C17H30KN2O6+ |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | potassium 3-[2-carboxyethyl-[2-(hept-6-enoylamino)ethyl]-(2-hydroxyethyl)azaniumyl]propanoate |
| SMILES | C=CCCCCC(=O)NCC[N+](CCO)(CCC(=O)[O-])CCC(=O)O.[K+] |
| InChI | InChI=1S/C17H30N2O6.K/c1-2-3-4-5-6-15(21)18-9-12-19(13-14-20,10-7-16(22)23)11-8-17(24)25;/h2,20H,1,3-14H2,(H2-,18,21,22,23,24,25);/q;+1 |
| InChIKey | RHYXJFDDAFKXMT-UHFFFAOYSA-N |
| XLogP | -3.72 |
| TPSA | 126.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|