C21H38N2O6 — CID 177430456
5-[4-carboxybutyl-[2-[[(E)-hept-3-enoyl]amino]ethyl]-(2-hydroxyethyl)azaniumyl]pentanoate (PubChem CID 177430456) has the molecular formula C21H38N2O6 and a molecular weight of 414.54 g/mol. Its IUPAC name is 5-[4-carboxybutyl-[2-[[(E)-hept-3-enoyl]amino]ethyl]-(2-hydroxyethyl)azaniumyl]pentanoate.
| Compound Name | 5-[4-carboxybutyl-[2-[[(E)-hept-3-enoyl]amino]ethyl]-(2-hydroxyethyl)azaniumyl]pentanoate |
|---|---|
| PubChem CID | 177430456 |
| Molecular Formula | C21H38N2O6 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | 5-[4-carboxybutyl-[2-[[(E)-hept-3-enoyl]amino]ethyl]-(2-hydroxyethyl)azaniumyl]pentanoate |
| SMILES | CCC/C=C/CC(=O)NCC[N+](CCO)(CCCCC(=O)[O-])CCCCC(=O)O |
| InChI | InChI=1S/C21H38N2O6/c1-2-3-4-5-10-19(25)22-13-16-23(17-18-24,14-8-6-11-20(26)27)15-9-7-12-21(28)29/h4-5,24H,2-3,6-18H2,1H3,(H2-,22,25,26,27,28,29)/b5-4+ |
| InChIKey | UZRBDEUZGWFANR-SNAWJCMRSA-N |
| XLogP | 0.83 |
| TPSA | 126.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|