C21H38N2NaO6+ — CID 101281034
sodium 5-[4-carboxybutyl-[2-[[(E)-hept-4-enoyl]amino]ethyl]-(2-hydroxyethyl)azaniumyl]pentanoate (PubChem CID 101281034) has the molecular formula C21H38N2NaO6+ and a molecular weight of 437.53 g/mol. Its IUPAC name is sodium 5-[4-carboxybutyl-[2-[[(E)-hept-4-enoyl]amino]ethyl]-(2-hydroxyethyl)azaniumyl]pentanoate.
| Compound Name | sodium 5-[4-carboxybutyl-[2-[[(E)-hept-4-enoyl]amino]ethyl]-(2-hydroxyethyl)azaniumyl]pentanoate |
|---|---|
| PubChem CID | 101281034 |
| Molecular Formula | C21H38N2NaO6+ |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | sodium 5-[4-carboxybutyl-[2-[[(E)-hept-4-enoyl]amino]ethyl]-(2-hydroxyethyl)azaniumyl]pentanoate |
| SMILES | CC/C=C/CCC(=O)NCC[N+](CCO)(CCCCC(=O)[O-])CCCCC(=O)O.[Na+] |
| InChI | InChI=1S/C21H38N2O6.Na/c1-2-3-4-5-10-19(25)22-13-16-23(17-18-24,14-8-6-11-20(26)27)15-9-7-12-21(28)29;/h3-4,24H,2,5-18H2,1H3,(H2-,22,25,26,27,28,29);/q;+1/b4-3+; |
| InChIKey | UYFKFHRLRCVTFB-BJILWQEISA-N |
| XLogP | -2.16 |
| TPSA | 126.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|