C34H60CaN4O12+2 — CID 101280713
calcium bis(3-[2-carboxyethyl-[2-[[(E)-hept-4-enoyl]amino]ethyl]-(2-hydroxyethyl)azaniumyl]propanoate) (PubChem CID 101280713) has the molecular formula C34H60CaN4O12+2 and a molecular weight of 756.95 g/mol. Its IUPAC name is calcium bis(3-[2-carboxyethyl-[2-[[(E)-hept-4-enoyl]amino]ethyl]-(2-hydroxyethyl)azaniumyl]propanoate).
| Compound Name | calcium bis(3-[2-carboxyethyl-[2-[[(E)-hept-4-enoyl]amino]ethyl]-(2-hydroxyethyl)azaniumyl]propanoate) |
|---|---|
| PubChem CID | 101280713 |
| Molecular Formula | C34H60CaN4O12+2 |
| Molecular Weight | 756.95 g/mol |
| Exact Mass | 756.38 |
| IUPAC Name | calcium bis(3-[2-carboxyethyl-[2-[[(E)-hept-4-enoyl]amino]ethyl]-(2-hydroxyethyl)azaniumyl]propanoate) |
| SMILES | CC/C=C/CCC(=O)NCC[N+](CCO)(CCC(=O)[O-])CCC(=O)O.CC/C=C/CCC(=O)NCC[N+](CCO)(CCC(=O)[O-])CCC(=O)O.[Ca+2] |
| InChI | InChI=1S/2C17H30N2O6.Ca/c2*1-2-3-4-5-6-15(21)18-9-12-19(13-14-20,10-7-16(22)23)11-8-17(24)25;/h2*3-4,20H,2,5-14H2,1H3,(H2-,18,21,22,23,24,25);/q;;+2/b2*4-3+; |
| InChIKey | ZZWBFDBSFIALDW-SYWGCQIGSA-N |
| XLogP | -1.84 |
| TPSA | 253.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.95 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|