C21H38KN2O6+ — CID 101281004
potassium 2-[[2-carboxybutyl-[2-[[(E)-hept-4-enoyl]amino]ethyl]-(2-hydroxyethyl)azaniumyl]methyl]butanoate (PubChem CID 101281004) has the molecular formula C21H38KN2O6+ and a molecular weight of 453.64 g/mol. Its IUPAC name is potassium 2-[[2-carboxybutyl-[2-[[(E)-hept-4-enoyl]amino]ethyl]-(2-hydroxyethyl)azaniumyl]methyl]butanoate.
| Compound Name | potassium 2-[[2-carboxybutyl-[2-[[(E)-hept-4-enoyl]amino]ethyl]-(2-hydroxyethyl)azaniumyl]methyl]butanoate |
|---|---|
| PubChem CID | 101281004 |
| Molecular Formula | C21H38KN2O6+ |
| Molecular Weight | 453.64 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | potassium 2-[[2-carboxybutyl-[2-[[(E)-hept-4-enoyl]amino]ethyl]-(2-hydroxyethyl)azaniumyl]methyl]butanoate |
| SMILES | CC/C=C/CCC(=O)NCC[N+](CCO)(CC(CC)C(=O)[O-])CC(CC)C(=O)O.[K+] |
| InChI | InChI=1S/C21H38N2O6.K/c1-4-7-8-9-10-19(25)22-11-12-23(13-14-24,15-17(5-2)20(26)27)16-18(6-3)21(28)29;/h7-8,17-18,24H,4-6,9-16H2,1-3H3,(H2-,22,25,26,27,28,29);/q;+1/b8-7+; |
| InChIKey | GPQODJUBWGWJFU-USRGLUTNSA-N |
| XLogP | -2.45 |
| TPSA | 126.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.64 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|