C19H36N2NaO6+ — CID 101280726
sodium 3-[2-carboxypropyl-[2-(heptanoylamino)ethyl]-(2-hydroxyethyl)azaniumyl]-2-methylpropanoate (PubChem CID 101280726) has the molecular formula C19H36N2NaO6+ and a molecular weight of 411.50 g/mol. Its IUPAC name is sodium 3-[2-carboxypropyl-[2-(heptanoylamino)ethyl]-(2-hydroxyethyl)azaniumyl]-2-methylpropanoate.
| Compound Name | sodium 3-[2-carboxypropyl-[2-(heptanoylamino)ethyl]-(2-hydroxyethyl)azaniumyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 101280726 |
| Molecular Formula | C19H36N2NaO6+ |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | sodium 3-[2-carboxypropyl-[2-(heptanoylamino)ethyl]-(2-hydroxyethyl)azaniumyl]-2-methylpropanoate |
| SMILES | CCCCCCC(=O)NCC[N+](CCO)(CC(C)C(=O)[O-])CC(C)C(=O)O.[Na+] |
| InChI | InChI=1S/C19H36N2O6.Na/c1-4-5-6-7-8-17(23)20-9-10-21(11-12-22,13-15(2)18(24)25)14-16(3)19(26)27;/h15-16,22H,4-14H2,1-3H3,(H2-,20,23,24,25,26,27);/q;+1 |
| InChIKey | JKGZYBIZBZLNDD-UHFFFAOYSA-N |
| XLogP | -3.01 |
| TPSA | 126.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|