C42H76CaN4O12+2 — CID 101281048
calcium bis(4-[3-carboxybutyl-[2-[[(E)-hept-3-enoyl]amino]ethyl]-(2-hydroxyethyl)azaniumyl]-2-methylbutanoate) (PubChem CID 101281048) has the molecular formula C42H76CaN4O12+2 and a molecular weight of 869.16 g/mol. Its IUPAC name is calcium bis(4-[3-carboxybutyl-[2-[[(E)-hept-3-enoyl]amino]ethyl]-(2-hydroxyethyl)azaniumyl]-2-methylbutanoate).
| Compound Name | calcium bis(4-[3-carboxybutyl-[2-[[(E)-hept-3-enoyl]amino]ethyl]-(2-hydroxyethyl)azaniumyl]-2-methylbutanoate) |
|---|---|
| PubChem CID | 101281048 |
| Molecular Formula | C42H76CaN4O12+2 |
| Molecular Weight | 869.16 g/mol |
| Exact Mass | 868.51 |
| IUPAC Name | calcium bis(4-[3-carboxybutyl-[2-[[(E)-hept-3-enoyl]amino]ethyl]-(2-hydroxyethyl)azaniumyl]-2-methylbutanoate) |
| SMILES | CCC/C=C/CC(=O)NCC[N+](CCO)(CCC(C)C(=O)[O-])CCC(C)C(=O)O.CCC/C=C/CC(=O)NCC[N+](CCO)(CCC(C)C(=O)[O-])CCC(C)C(=O)O.[Ca+2] |
| InChI | InChI=1S/2C21H38N2O6.Ca/c2*1-4-5-6-7-8-19(25)22-11-14-23(15-16-24,12-9-17(2)20(26)27)13-10-18(3)21(28)29;/h2*6-7,17-18,24H,4-5,8-16H2,1-3H3,(H2-,22,25,26,27,28,29);/q;;+2/b2*7-6+; |
| InChIKey | LTTICLSFJBGOTK-RWUXNGIBSA-N |
| XLogP | 0.71 |
| TPSA | 253.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.16 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|