C21H39N2O6+ — CID 101280969
bis(3-carboxybutyl)-[2-[[(E)-hept-4-enoyl]amino]ethyl]-(2-hydroxyethyl)azanium (PubChem CID 101280969) has the molecular formula C21H39N2O6+ and a molecular weight of 415.55 g/mol. Its IUPAC name is bis(3-carboxybutyl)-[2-[[(E)-hept-4-enoyl]amino]ethyl]-(2-hydroxyethyl)azanium.
| Compound Name | bis(3-carboxybutyl)-[2-[[(E)-hept-4-enoyl]amino]ethyl]-(2-hydroxyethyl)azanium |
|---|---|
| PubChem CID | 101280969 |
| Molecular Formula | C21H39N2O6+ |
| Molecular Weight | 415.55 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | bis(3-carboxybutyl)-[2-[[(E)-hept-4-enoyl]amino]ethyl]-(2-hydroxyethyl)azanium |
| SMILES | CC/C=C/CCC(=O)NCC[N+](CCO)(CCC(C)C(=O)O)CCC(C)C(=O)O |
| InChI | InChI=1S/C21H38N2O6/c1-4-5-6-7-8-19(25)22-11-14-23(15-16-24,12-9-17(2)20(26)27)13-10-18(3)21(28)29/h5-6,17-18,24H,4,7-16H2,1-3H3,(H2-,22,25,26,27,28,29)/p+1/b6-5+ |
| InChIKey | KFDLQVPUBSTGFM-AATRIKPKSA-O |
| XLogP | 1.88 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.55 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|