C29H54NO6+ — CID 177475176
tris(3-carboxybutyl)-[(E)-tetradec-4-enyl]azanium (PubChem CID 177475176) has the molecular formula C29H54NO6+ and a molecular weight of 512.75 g/mol. Its IUPAC name is tris(3-carboxybutyl)-[(E)-tetradec-4-enyl]azanium.
| Compound Name | tris(3-carboxybutyl)-[(E)-tetradec-4-enyl]azanium |
|---|---|
| PubChem CID | 177475176 |
| Molecular Formula | C29H54NO6+ |
| Molecular Weight | 512.75 g/mol |
| Exact Mass | 512.39 |
| IUPAC Name | tris(3-carboxybutyl)-[(E)-tetradec-4-enyl]azanium |
| SMILES | CCCCCCCCC/C=C/CCC[N+](CCC(C)C(=O)O)(CCC(C)C(=O)O)CCC(C)C(=O)O |
| InChI | InChI=1S/C29H53NO6/c1-5-6-7-8-9-10-11-12-13-14-15-16-20-30(21-17-24(2)27(31)32,22-18-25(3)28(33)34)23-19-26(4)29(35)36/h13-14,24-26H,5-12,15-23H2,1-4H3,(H2-,31,32,33,34,35,36)/p+1/b14-13+ |
| InChIKey | XGMFSEASEAKSBZ-BUHFOSPRSA-O |
| XLogP | 6.61 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.75 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|