C32H59NO6 — CID 177443934
3-[bis(2-carboxypropyl)-[(E)-icos-9-enyl]azaniumyl]-2-methylpropanoate (PubChem CID 177443934) has the molecular formula C32H59NO6 and a molecular weight of 553.83 g/mol. Its IUPAC name is 3-[bis(2-carboxypropyl)-[(E)-icos-9-enyl]azaniumyl]-2-methylpropanoate.
| Compound Name | 3-[bis(2-carboxypropyl)-[(E)-icos-9-enyl]azaniumyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 177443934 |
| Molecular Formula | C32H59NO6 |
| Molecular Weight | 553.83 g/mol |
| Exact Mass | 553.43 |
| IUPAC Name | 3-[bis(2-carboxypropyl)-[(E)-icos-9-enyl]azaniumyl]-2-methylpropanoate |
| SMILES | CCCCCCCCCC/C=C/CCCCCCCC[N+](CC(C)C(=O)[O-])(CC(C)C(=O)O)CC(C)C(=O)O |
| InChI | InChI=1S/C32H59NO6/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-33(24-27(2)30(34)35,25-28(3)31(36)37)26-29(4)32(38)39/h14-15,27-29H,5-13,16-26H2,1-4H3,(H2-,34,35,36,37,38,39)/b15-14+ |
| InChIKey | QWEOBLKOCIQILD-CCEZHUSRSA-N |
| XLogP | 6.45 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.83 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|