C34H66CaN2O10+2 — CID 101279524
calcium bis(3-[2-carboxypropyl-(hydroxymethyl)-octylazaniumyl]-2-methylpropanoate) (PubChem CID 101279524) has the molecular formula C34H66CaN2O10+2 and a molecular weight of 702.98 g/mol. Its IUPAC name is calcium bis(3-[2-carboxypropyl-(hydroxymethyl)-octylazaniumyl]-2-methylpropanoate).
| Compound Name | calcium bis(3-[2-carboxypropyl-(hydroxymethyl)-octylazaniumyl]-2-methylpropanoate) |
|---|---|
| PubChem CID | 101279524 |
| Molecular Formula | C34H66CaN2O10+2 |
| Molecular Weight | 702.98 g/mol |
| Exact Mass | 702.43 |
| IUPAC Name | calcium bis(3-[2-carboxypropyl-(hydroxymethyl)-octylazaniumyl]-2-methylpropanoate) |
| SMILES | CCCCCCCC[N+](CO)(CC(C)C(=O)[O-])CC(C)C(=O)O.CCCCCCCC[N+](CO)(CC(C)C(=O)[O-])CC(C)C(=O)O.[Ca+2] |
| InChI | InChI=1S/2C17H33NO5.Ca/c2*1-4-5-6-7-8-9-10-18(13-19,11-14(2)16(20)21)12-15(3)17(22)23;/h2*14-15,19H,4-13H2,1-3H3,(H-,20,21,22,23);/q;;+2 |
| InChIKey | RGQVSHZQWGXYAG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 195.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.98 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|