C18H33LiNO5+ — CID 101281967
lithium 3-[2-carboxypropyl-(2-hydroxyethyl)-[(E)-oct-4-enyl]azaniumyl]-2-methylpropanoate (PubChem CID 101281967) has the molecular formula C18H33LiNO5+ and a molecular weight of 350.41 g/mol. Its IUPAC name is lithium 3-[2-carboxypropyl-(2-hydroxyethyl)-[(E)-oct-4-enyl]azaniumyl]-2-methylpropanoate.
| Compound Name | lithium 3-[2-carboxypropyl-(2-hydroxyethyl)-[(E)-oct-4-enyl]azaniumyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 101281967 |
| Molecular Formula | C18H33LiNO5+ |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | lithium 3-[2-carboxypropyl-(2-hydroxyethyl)-[(E)-oct-4-enyl]azaniumyl]-2-methylpropanoate |
| SMILES | CCC/C=C/CCC[N+](CCO)(CC(C)C(=O)[O-])CC(C)C(=O)O.[Li+] |
| InChI | InChI=1S/C18H33NO5.Li/c1-4-5-6-7-8-9-10-19(11-12-20,13-15(2)17(21)22)14-16(3)18(23)24;/h6-7,15-16,20H,4-5,8-14H2,1-3H3,(H-,21,22,23,24);/q;+1/b7-6+; |
| InChIKey | VPPRIWDIDVPUHC-UHDJGPCESA-N |
| XLogP | -1.96 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|