C17H31KNO5+ — CID 101281855
potassium 3-[2-carboxypropyl-(hydroxymethyl)-[(E)-oct-4-enyl]azaniumyl]-2-methylpropanoate (PubChem CID 101281855) has the molecular formula C17H31KNO5+ and a molecular weight of 368.54 g/mol. Its IUPAC name is potassium 3-[2-carboxypropyl-(hydroxymethyl)-[(E)-oct-4-enyl]azaniumyl]-2-methylpropanoate.
| Compound Name | potassium 3-[2-carboxypropyl-(hydroxymethyl)-[(E)-oct-4-enyl]azaniumyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 101281855 |
| Molecular Formula | C17H31KNO5+ |
| Molecular Weight | 368.54 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | potassium 3-[2-carboxypropyl-(hydroxymethyl)-[(E)-oct-4-enyl]azaniumyl]-2-methylpropanoate |
| SMILES | CCC/C=C/CCC[N+](CO)(CC(C)C(=O)[O-])CC(C)C(=O)O.[K+] |
| InChI | InChI=1S/C17H31NO5.K/c1-4-5-6-7-8-9-10-18(13-19,11-14(2)16(20)21)12-15(3)17(22)23;/h6-7,14-15,19H,4-5,8-13H2,1-3H3,(H-,20,21,22,23);/q;+1/b7-6+; |
| InChIKey | LZDAEYRRFUNXDB-UHDJGPCESA-N |
| XLogP | -2.00 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.54 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|