C17H34NO5+ — CID 101279520
bis(2-carboxypropyl)-(hydroxymethyl)-octylazanium (PubChem CID 101279520) has the molecular formula C17H34NO5+ and a molecular weight of 332.46 g/mol. Its IUPAC name is bis(2-carboxypropyl)-(hydroxymethyl)-octylazanium.
| Compound Name | bis(2-carboxypropyl)-(hydroxymethyl)-octylazanium |
|---|---|
| PubChem CID | 101279520 |
| Molecular Formula | C17H34NO5+ |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | bis(2-carboxypropyl)-(hydroxymethyl)-octylazanium |
| SMILES | CCCCCCCC[N+](CO)(CC(C)C(=O)O)CC(C)C(=O)O |
| InChI | InChI=1S/C17H33NO5/c1-4-5-6-7-8-9-10-18(13-19,11-14(2)16(20)21)12-15(3)17(22)23/h14-15,19H,4-13H2,1-3H3,(H-,20,21,22,23)/p+1 |
| InChIKey | CUBQCQXSJMGNJE-UHFFFAOYSA-O |
| XLogP | 2.55 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|