C15H26KN2O6+ — CID 101280643
potassium 2-[carboxymethyl-[2-[[(E)-hept-4-enoyl]amino]ethyl]-(2-hydroxyethyl)azaniumyl]acetate (PubChem CID 101280643) has the molecular formula C15H26KN2O6+ and a molecular weight of 369.48 g/mol. Its IUPAC name is potassium 2-[carboxymethyl-[2-[[(E)-hept-4-enoyl]amino]ethyl]-(2-hydroxyethyl)azaniumyl]acetate.
| Compound Name | potassium 2-[carboxymethyl-[2-[[(E)-hept-4-enoyl]amino]ethyl]-(2-hydroxyethyl)azaniumyl]acetate |
|---|---|
| PubChem CID | 101280643 |
| Molecular Formula | C15H26KN2O6+ |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | potassium 2-[carboxymethyl-[2-[[(E)-hept-4-enoyl]amino]ethyl]-(2-hydroxyethyl)azaniumyl]acetate |
| SMILES | CC/C=C/CCC(=O)NCC[N+](CCO)(CC(=O)[O-])CC(=O)O.[K+] |
| InChI | InChI=1S/C15H26N2O6.K/c1-2-3-4-5-6-13(19)16-7-8-17(9-10-18,11-14(20)21)12-15(22)23;/h3-4,18H,2,5-12H2,1H3,(H2-,16,19,20,21,22,23);/q;+1/b4-3+; |
| InChIKey | HOHIMBDDWJBRPS-BJILWQEISA-N |
| XLogP | -4.50 |
| TPSA | 126.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | -4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|