C19H35N2O6+ — CID 101280738
bis(2-carboxypropyl)-[2-[[(E)-hept-4-enoyl]amino]ethyl]-(2-hydroxyethyl)azanium (PubChem CID 101280738) has the molecular formula C19H35N2O6+ and a molecular weight of 387.50 g/mol. Its IUPAC name is bis(2-carboxypropyl)-[2-[[(E)-hept-4-enoyl]amino]ethyl]-(2-hydroxyethyl)azanium.
| Compound Name | bis(2-carboxypropyl)-[2-[[(E)-hept-4-enoyl]amino]ethyl]-(2-hydroxyethyl)azanium |
|---|---|
| PubChem CID | 101280738 |
| Molecular Formula | C19H35N2O6+ |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | bis(2-carboxypropyl)-[2-[[(E)-hept-4-enoyl]amino]ethyl]-(2-hydroxyethyl)azanium |
| SMILES | CC/C=C/CCC(=O)NCC[N+](CCO)(CC(C)C(=O)O)CC(C)C(=O)O |
| InChI | InChI=1S/C19H34N2O6/c1-4-5-6-7-8-17(23)20-9-10-21(11-12-22,13-15(2)18(24)25)14-16(3)19(26)27/h5-6,15-16,22H,4,7-14H2,1-3H3,(H2-,20,23,24,25,26,27)/p+1/b6-5+ |
| InChIKey | VXAPTHGBEOKSJE-AATRIKPKSA-O |
| XLogP | 1.10 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|